About (2-propoxyphenyl)boronic acid
(2-propoxyphenyl)boronic acid (PubChem CID 4219796) has the molecular formula C9H13BO3
and a molecular weight of 180.01 g/mol. Its IUPAC name is (2-propoxyphenyl)boronic acid.
Molecular Properties
| Compound Name | (2-propoxyphenyl)boronic acid |
| PubChem CID | 4219796 |
| Molecular Formula | C9H13BO3 |
| Molecular Weight | 180.01 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2-propoxyphenyl)boronic acid |
| SMILES | CCCOc1ccccc1B(O)O |
| InChI | InChI=1S/C9H13BO3/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h3-6,11-12H,2,7H2,1H3 |
| InChIKey | ZDPMWYOVDLDQDT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.01 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-propoxyphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propoxyphenyl)boronic acid?
The IUPAC name of (2-propoxyphenyl)boronic acid (CID 4219796) is (2-propoxyphenyl)boronic acid.
What is the SMILES notation for (2-propoxyphenyl)boronic acid?
The canonical SMILES for (2-propoxyphenyl)boronic acid is CCCOc1ccccc1B(O)O.
What is the InChIKey of (2-propoxyphenyl)boronic acid?
The InChIKey is ZDPMWYOVDLDQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BO3/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h3-6,11-12H,2,7H2,1H3.
What are the key properties of (2-propoxyphenyl)boronic acid?
(2-propoxyphenyl)boronic acid has a molecular weight of 180.01 g/mol, XLogP of 0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propoxyphenyl)boronic acid is sourced from PubChem (CID 4219796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).