About sodium 2-ethoxyphenolate
sodium 2-ethoxyphenolate (PubChem CID 23671657) has the molecular formula C8H9NaO2
and a molecular weight of 160.15 g/mol. Its IUPAC name is sodium 2-ethoxyphenolate.
Molecular Properties
| Compound Name | sodium 2-ethoxyphenolate |
| PubChem CID | 23671657 |
| Molecular Formula | C8H9NaO2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | sodium 2-ethoxyphenolate |
| SMILES | CCOc1ccccc1[O-].[Na+] |
| InChI | InChI=1S/C8H10O2.Na/c1-2-10-8-6-4-3-5-7(8)9;/h3-6,9H,2H2,1H3;/q;+1/p-1 |
| InChIKey | MLUSGSAOOAWMFU-UHFFFAOYSA-M |
| XLogP | -1.84 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 2-ethoxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-ethoxyphenolate?
The IUPAC name of sodium 2-ethoxyphenolate (CID 23671657) is sodium 2-ethoxyphenolate.
What is the SMILES notation for sodium 2-ethoxyphenolate?
The canonical SMILES for sodium 2-ethoxyphenolate is CCOc1ccccc1[O-].[Na+].
What is the InChIKey of sodium 2-ethoxyphenolate?
The InChIKey is MLUSGSAOOAWMFU-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O2.Na/c1-2-10-8-6-4-3-5-7(8)9;/h3-6,9H,2H2,1H3;/q;+1/p-1.
What are the key properties of sodium 2-ethoxyphenolate?
sodium 2-ethoxyphenolate has a molecular weight of 160.15 g/mol, XLogP of -1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-ethoxyphenolate is sourced from PubChem (CID 23671657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).