About trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate
trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate (PubChem CID 172755779) has the molecular formula C23H25Na3O6
and a molecular weight of 466.42 g/mol. Its IUPAC name is trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate.
Molecular Properties
| Compound Name | trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate |
| PubChem CID | 172755779 |
| Molecular Formula | C23H25Na3O6 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate |
| SMILES | CCOc1ccc([O-])cc1.CCOc1ccccc1[O-].COc1cccc([O-])c1.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/2C8H10O2.C7H8O2.3Na/c1-2-10-8-5-3-7(9)4-6-8;1-2-10-8-6-4-3-5-7(8)9;1-9-7-4-2-3-6(8)5-7;;;/h2*3-6,9H,2H2,1H3;2-5,8H,1H3;;;/q;;;3*+1/p-3 |
| InChIKey | KZRLBCIQDKOQLB-UHFFFAOYSA-K |
| XLogP | -5.90 |
| TPSA | 96.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | -5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate?
The IUPAC name of trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate (CID 172755779) is trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate.
What is the SMILES notation for trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate?
The canonical SMILES for trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate is CCOc1ccc([O-])cc1.CCOc1ccccc1[O-].COc1cccc([O-])c1.[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate?
The InChIKey is KZRLBCIQDKOQLB-UHFFFAOYSA-K. The full InChI is InChI=1S/2C8H10O2.C7H8O2.3Na/c1-2-10-8-5-3-7(9)4-6-8;1-2-10-8-6-4-3-5-7(8)9;1-9-7-4-2-3-6(8)5-7;;;/h2*3-6,9H,2H2,1H3;2-5,8H,1H3;;;/q;;;3*+1/p-3.
What are the key properties of trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate?
trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate has a molecular weight of 466.42 g/mol, XLogP of -5.90, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;2-ethoxyphenolate;4-ethoxyphenolate;3-methoxyphenolate is sourced from PubChem (CID 172755779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).