About magnesium bis(3-methoxyphenolate)
magnesium bis(3-methoxyphenolate) (PubChem CID 10858575) has the molecular formula C14H14MgO4
and a molecular weight of 270.57 g/mol. Its IUPAC name is magnesium bis(3-methoxyphenolate).
Molecular Properties
| Compound Name | magnesium bis(3-methoxyphenolate) |
| PubChem CID | 10858575 |
| Molecular Formula | C14H14MgO4 |
| Molecular Weight | 270.57 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | magnesium bis(3-methoxyphenolate) |
| SMILES | COc1cccc([O-])c1.COc1cccc([O-])c1.[Mg+2] |
| InChI | InChI=1S/2C7H8O2.Mg/c2*1-9-7-4-2-3-6(8)5-7;/h2*2-5,8H,1H3;/q;;+2/p-2 |
| InChIKey | YTAURYICCYOTOZ-UHFFFAOYSA-L |
| XLogP | 1.16 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(3-methoxyphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(3-methoxyphenolate)?
The IUPAC name of magnesium bis(3-methoxyphenolate) (CID 10858575) is magnesium bis(3-methoxyphenolate).
What is the SMILES notation for magnesium bis(3-methoxyphenolate)?
The canonical SMILES for magnesium bis(3-methoxyphenolate) is COc1cccc([O-])c1.COc1cccc([O-])c1.[Mg+2].
What is the InChIKey of magnesium bis(3-methoxyphenolate)?
The InChIKey is YTAURYICCYOTOZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8O2.Mg/c2*1-9-7-4-2-3-6(8)5-7;/h2*2-5,8H,1H3;/q;;+2/p-2.
What are the key properties of magnesium bis(3-methoxyphenolate)?
magnesium bis(3-methoxyphenolate) has a molecular weight of 270.57 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(3-methoxyphenolate) is sourced from PubChem (CID 10858575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).