C32H38N6+2 — CID 42631548
1-N,3-N-dimethyl-1-N,3-N-bis[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]benzene-1,3-diamine (PubChem CID 42631548) has the molecular formula C32H38N6+2 and a molecular weight of 506.70 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-1-N,3-N-bis[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-dimethyl-1-N,3-N-bis[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]benzene-1,3-diamine |
|---|---|
| PubChem CID | 42631548 |
| Molecular Formula | C32H38N6+2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 1-N,3-N-dimethyl-1-N,3-N-bis[(E)-(1,3,3-trimethylindol-1-ium-2-yl)methylideneamino]benzene-1,3-diamine |
| SMILES | CN(/N=C/C1=[N+](C)c2ccccc2C1(C)C)c1cccc(N(C)/N=C/C2=[N+](C)c3ccccc3C2(C)C)c1 |
| InChI | InChI=1S/C32H38N6/c1-31(2)25-16-9-11-18-27(25)35(5)29(31)21-33-37(7)23-14-13-15-24(20-23)38(8)34-22-30-32(3,4)26-17-10-12-19-28(26)36(30)6/h9-22H,1-8H3/q+2 |
| InChIKey | OYGNWNVYJKKHKP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 37.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|