C23H28N3O+ — CID 20599349
4-[3,3-dimethyl-2-[(E)-[methyl-(4-methylphenyl)hydrazinylidene]methyl]indol-1-ium-1-yl]butan-2-one (PubChem CID 20599349) has the molecular formula C23H28N3O+ and a molecular weight of 362.50 g/mol. Its IUPAC name is 4-[3,3-dimethyl-2-[(E)-[methyl-(4-methylphenyl)hydrazinylidene]methyl]indol-1-ium-1-yl]butan-2-one.
| Compound Name | 4-[3,3-dimethyl-2-[(E)-[methyl-(4-methylphenyl)hydrazinylidene]methyl]indol-1-ium-1-yl]butan-2-one |
|---|---|
| PubChem CID | 20599349 |
| Molecular Formula | C23H28N3O+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 4-[3,3-dimethyl-2-[(E)-[methyl-(4-methylphenyl)hydrazinylidene]methyl]indol-1-ium-1-yl]butan-2-one |
| SMILES | CC(=O)CC[N+]1=C(/C=N/N(C)c2ccc(C)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H28N3O/c1-17-10-12-19(13-11-17)25(5)24-16-22-23(3,4)20-8-6-7-9-21(20)26(22)15-14-18(2)27/h6-13,16H,14-15H2,1-5H3/q+1 |
| InChIKey | DTNYHZMOGDRZSP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|