C30H34N2O4 — CID 101252092
4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[4-[3-carboxypropyl(methyl)amino]phenyl]-3-oxocyclobuten-1-olate (PubChem CID 101252092) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[4-[3-carboxypropyl(methyl)amino]phenyl]-3-oxocyclobuten-1-olate.
| Compound Name | 4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[4-[3-carboxypropyl(methyl)amino]phenyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 101252092 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-[(1-butyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[4-[3-carboxypropyl(methyl)amino]phenyl]-3-oxocyclobuten-1-olate |
| SMILES | CCCC[N+]1=C(C=C2C(=O)C(c3ccc(N(C)CCCC(=O)O)cc3)=C2[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H34N2O4/c1-5-6-18-32-24-11-8-7-10-23(24)30(2,3)25(32)19-22-28(35)27(29(22)36)20-13-15-21(16-14-20)31(4)17-9-12-26(33)34/h7-8,10-11,13-16,19H,5-6,9,12,17-18H2,1-4H3,(H-,33,34,35,36) |
| InChIKey | WBSCOGGMAWOIKV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|