C38H47BrN2O2 — CID 132938463
2-[(5-bromo-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-hexyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 132938463) has the molecular formula C38H47BrN2O2 and a molecular weight of 643.71 g/mol. Its IUPAC name is 2-[(5-bromo-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-hexyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[(5-bromo-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-hexyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 132938463 |
| Molecular Formula | C38H47BrN2O2 |
| Molecular Weight | 643.71 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[(5-bromo-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1-hexyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCN1C(=CC2=C([O-])C(=CC3=[N+](CCCCCC)c4ccccc4C3(C)C)C2=O)C(C)(C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C38H47BrN2O2/c1-7-9-11-15-21-40-31-18-14-13-17-29(31)37(3,4)33(40)24-27-35(42)28(36(27)43)25-34-38(5,6)30-23-26(39)19-20-32(30)41(34)22-16-12-10-8-2/h13-14,17-20,23-25H,7-12,15-16,21-22H2,1-6H3 |
| InChIKey | QEWHLHJEZBCWQV-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.71 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|