C39H48N2O6 — CID 157485605
4-[[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate;methane (PubChem CID 157485605) has the molecular formula C39H48N2O6 and a molecular weight of 640.82 g/mol. Its IUPAC name is 4-[[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate;methane.
| Compound Name | 4-[[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate;methane |
|---|---|
| PubChem CID | 157485605 |
| Molecular Formula | C39H48N2O6 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | 4-[[1-(5-carboxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate;methane |
| SMILES | C.CC1(C)C(C=C2C(=O)C(/C=C3/N(CCCCCC(=O)O)c4ccccc4C3(C)C)=C2[O-])=[N+](CCCCCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C38H44N2O6.CH4/c1-37(2)27-15-9-11-17-29(27)39(21-13-5-7-19-33(41)42)31(37)23-25-35(45)26(36(25)46)24-32-38(3,4)28-16-10-12-18-30(28)40(32)22-14-6-8-20-34(43)44;/h9-12,15-18,23-24H,5-8,13-14,19-22H2,1-4H3,(H2-,41,42,43,44,45,46);1H4 |
| InChIKey | BWRGOGRVPHWAJE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|