C44H51BrN2O3 — CID 162702940
(4E)-4-[[1-(6-bromohexyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[3,3-dimethyl-1-(6-phenoxyhexyl)indol-2-ylidene]methyl]-3-oxocyclobuten-1-olate (PubChem CID 162702940) has the molecular formula C44H51BrN2O3 and a molecular weight of 735.81 g/mol. Its IUPAC name is (4E)-4-[[1-(6-bromohexyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[3,3-dimethyl-1-(6-phenoxyhexyl)indol-2-ylidene]methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4E)-4-[[1-(6-bromohexyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[3,3-dimethyl-1-(6-phenoxyhexyl)indol-2-ylidene]methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 162702940 |
| Molecular Formula | C44H51BrN2O3 |
| Molecular Weight | 735.81 g/mol |
| Exact Mass | 734.31 |
| IUPAC Name | (4E)-4-[[1-(6-bromohexyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(E)-[3,3-dimethyl-1-(6-phenoxyhexyl)indol-2-ylidene]methyl]-3-oxocyclobuten-1-olate |
| SMILES | CC1(C)C(/C=C2/C(=O)C(/C=C3/N(CCCCCCOc4ccccc4)c4ccccc4C3(C)C)=C2[O-])=[N+](CCCCCCBr)c2ccccc21 |
| InChI | InChI=1S/C44H51BrN2O3/c1-43(2)35-22-12-14-24-37(35)46(27-17-6-5-16-26-45)39(43)30-33-41(48)34(42(33)49)31-40-44(3,4)36-23-13-15-25-38(36)47(40)28-18-7-8-19-29-50-32-20-10-9-11-21-32/h9-15,20-25,30-31H,5-8,16-19,26-29H2,1-4H3 |
| InChIKey | GKZXBKPUCZQDQX-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.81 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|