C38H41N2O2+ — CID 58325770
(4Z)-4-[(1-hex-5-ynyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hex-5-ynyl-3,3-dimethylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 58325770) has the molecular formula C38H41N2O2+ and a molecular weight of 557.76 g/mol. Its IUPAC name is (4Z)-4-[(1-hex-5-ynyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hex-5-ynyl-3,3-dimethylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4Z)-4-[(1-hex-5-ynyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hex-5-ynyl-3,3-dimethylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 58325770 |
| Molecular Formula | C38H41N2O2+ |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | (4Z)-4-[(1-hex-5-ynyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-[(E)-(1-hex-5-ynyl-3,3-dimethylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | C#CCCCCN1/C(=C/C2=C(O)/C(=C/C3=[N+](CCCCC#C)c4ccccc4C3(C)C)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C38H40N2O2/c1-7-9-11-17-23-39-31-21-15-13-19-29(31)37(3,4)33(39)25-27-35(41)28(36(27)42)26-34-38(5,6)30-20-14-16-22-32(30)40(34)24-18-12-10-8-2/h1-2,13-16,19-22,25-26H,9-12,17-18,23-24H2,3-6H3/p+1 |
| InChIKey | OCDWMCLAFQLVMB-UHFFFAOYSA-O |
| XLogP | 7.67 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|