C39H45N2O2S+ — CID 59449436
4-[(3,3-dimethyl-1-propylindol-1-ium-2-yl)methylidene]-2-[(1-hexyl-3,3-dimethyl-5-thiophen-2-ylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 59449436) has the molecular formula C39H45N2O2S+ and a molecular weight of 605.87 g/mol. Its IUPAC name is 4-[(3,3-dimethyl-1-propylindol-1-ium-2-yl)methylidene]-2-[(1-hexyl-3,3-dimethyl-5-thiophen-2-ylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[(3,3-dimethyl-1-propylindol-1-ium-2-yl)methylidene]-2-[(1-hexyl-3,3-dimethyl-5-thiophen-2-ylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 59449436 |
| Molecular Formula | C39H45N2O2S+ |
| Molecular Weight | 605.87 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | 4-[(3,3-dimethyl-1-propylindol-1-ium-2-yl)methylidene]-2-[(1-hexyl-3,3-dimethyl-5-thiophen-2-ylindol-2-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCCCN1C(=CC2=C(O)C(=CC3=[N+](CCC)c4ccccc4C3(C)C)C2=O)C(C)(C)c2cc(-c3cccs3)ccc21 |
| InChI | InChI=1S/C39H44N2O2S/c1-7-9-10-13-21-41-32-19-18-26(33-17-14-22-44-33)23-30(32)39(5,6)35(41)25-28-36(42)27(37(28)43)24-34-38(3,4)29-15-11-12-16-31(29)40(34)20-8-2/h11-12,14-19,22-25H,7-10,13,20-21H2,1-6H3/p+1 |
| InChIKey | BVMFSAICYRXYIX-UHFFFAOYSA-O |
| XLogP | 9.78 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.87 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|