C45H62ClN2O3+ — CID 123761277
2-[(5-chloro-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(3,3-dimethyl-1-octyl-5-propan-2-yloxyindol-1-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one (PubChem CID 123761277) has the molecular formula C45H62ClN2O3+ and a molecular weight of 714.45 g/mol. Its IUPAC name is 2-[(5-chloro-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(3,3-dimethyl-1-octyl-5-propan-2-yloxyindol-1-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 2-[(5-chloro-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(3,3-dimethyl-1-octyl-5-propan-2-yloxyindol-1-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 123761277 |
| Molecular Formula | C45H62ClN2O3+ |
| Molecular Weight | 714.45 g/mol |
| Exact Mass | 713.44 |
| IUPAC Name | 2-[(5-chloro-3,3-dimethyl-1-octylindol-2-ylidene)methyl]-4-[(3,3-dimethyl-1-octyl-5-propan-2-yloxyindol-1-ium-2-yl)methylidene]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCCCCCN1C(=CC2=C(O)C(=CC3=[N+](CCCCCCCC)c4ccc(OC(C)C)cc4C3(C)C)C2=O)C(C)(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C45H61ClN2O3/c1-9-11-13-15-17-19-25-47-38-23-21-32(46)27-36(38)44(5,6)40(47)29-34-42(49)35(43(34)50)30-41-45(7,8)37-28-33(51-31(3)4)22-24-39(37)48(41)26-20-18-16-14-12-10-2/h21-24,27-31H,9-20,25-26H2,1-8H3/p+1 |
| InChIKey | YATFXCZRRHUUKT-UHFFFAOYSA-O |
| XLogP | 12.23 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.45 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|