C33H37N2O4+ — CID 137169568
6-[(2Z)-2-[[(3Z)-2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]hexanoic acid (PubChem CID 137169568) has the molecular formula C33H37N2O4+ and a molecular weight of 525.67 g/mol. Its IUPAC name is 6-[(2Z)-2-[[(3Z)-2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2Z)-2-[[(3Z)-2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 137169568 |
| Molecular Formula | C33H37N2O4+ |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 6-[(2Z)-2-[[(3Z)-2-hydroxy-4-oxo-3-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobuten-1-yl]methylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
| SMILES | C[N+]1=C(/C=C2\C(=O)C(/C=C3\N(CCCCCC(=O)O)c4ccccc4C3(C)C)=C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C33H36N2O4/c1-32(2)23-13-8-10-15-25(23)34(5)27(32)19-21-30(38)22(31(21)39)20-28-33(3,4)24-14-9-11-16-26(24)35(28)18-12-6-7-17-29(36)37/h8-11,13-16,19-20H,6-7,12,17-18H2,1-5H3,(H-,36,37,38,39)/p+1 |
| InChIKey | WOLJXBHNKJVQGJ-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|