C43H51N3O4 — CID 101394919
2-[4-(dibutylamino)phenyl]-4-[[3,3-dimethyl-1-[2-[4-(1-methylpyrrolidin-2-yl)benzoyl]oxyethyl]indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate (PubChem CID 101394919) has the molecular formula C43H51N3O4 and a molecular weight of 673.90 g/mol. Its IUPAC name is 2-[4-(dibutylamino)phenyl]-4-[[3,3-dimethyl-1-[2-[4-(1-methylpyrrolidin-2-yl)benzoyl]oxyethyl]indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[4-(dibutylamino)phenyl]-4-[[3,3-dimethyl-1-[2-[4-(1-methylpyrrolidin-2-yl)benzoyl]oxyethyl]indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 101394919 |
| Molecular Formula | C43H51N3O4 |
| Molecular Weight | 673.90 g/mol |
| Exact Mass | 673.39 |
| IUPAC Name | 2-[4-(dibutylamino)phenyl]-4-[[3,3-dimethyl-1-[2-[4-(1-methylpyrrolidin-2-yl)benzoyl]oxyethyl]indol-1-ium-2-yl]methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCN(CCCC)c1ccc(C2=C([O-])C(=CC3=[N+](CCOC(=O)c4ccc(C5CCCN5C)cc4)c4ccccc4C3(C)C)C2=O)cc1 |
| InChI | InChI=1S/C43H51N3O4/c1-6-8-25-45(26-9-7-2)33-22-20-31(21-23-33)39-40(47)34(41(39)48)29-38-43(3,4)35-13-10-11-14-37(35)46(38)27-28-50-42(49)32-18-16-30(17-19-32)36-15-12-24-44(36)5/h10-11,13-14,16-23,29,36H,6-9,12,15,24-28H2,1-5H3 |
| InChIKey | QGQLLEVTSLYWPL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.90 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|