C33H39N2O6+ — CID 102507856
1-(2-carboxyethyl)-2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-carboxylic acid (PubChem CID 102507856) has the molecular formula C33H39N2O6+ and a molecular weight of 559.68 g/mol. Its IUPAC name is 1-(2-carboxyethyl)-2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-carboxylic acid.
| Compound Name | 1-(2-carboxyethyl)-2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 102507856 |
| Molecular Formula | C33H39N2O6+ |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 1-(2-carboxyethyl)-2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-carboxylic acid |
| SMILES | CCCCN(CCCC)c1ccc(C2=C(O)C(=CC3=[N+](CCC(=O)O)c4ccc(C(=O)O)cc4C3(C)C)C2=O)cc1 |
| InChI | InChI=1S/C33H38N2O6/c1-5-7-16-34(17-8-6-2)23-12-9-21(10-13-23)29-30(38)24(31(29)39)20-27-33(3,4)25-19-22(32(40)41)11-14-26(25)35(27)18-15-28(36)37/h9-14,19-20H,5-8,15-18H2,1-4H3,(H2-,36,37,38,39,40,41)/p+1 |
| InChIKey | HMXIABOLPDXXRM-UHFFFAOYSA-O |
| XLogP | 6.12 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|