C28H29FNO5+ — CID 159170001
5-[5-fluoro-2-[[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]pentyl formate (PubChem CID 159170001) has the molecular formula C28H29FNO5+ and a molecular weight of 478.54 g/mol. Its IUPAC name is 5-[5-fluoro-2-[[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]pentyl formate.
| Compound Name | 5-[5-fluoro-2-[[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]pentyl formate |
|---|---|
| PubChem CID | 159170001 |
| Molecular Formula | C28H29FNO5+ |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5-[5-fluoro-2-[[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]pentyl formate |
| SMILES | COc1ccc(C2=C(O)C(=CC3=[N+](CCCCCOC=O)c4ccc(F)cc4C3(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H28FNO5/c1-28(2)22-15-19(29)9-12-23(22)30(13-5-4-6-14-35-17-31)24(28)16-21-26(32)25(27(21)33)18-7-10-20(34-3)11-8-18/h7-12,15-17H,4-6,13-14H2,1-3H3/p+1 |
| InChIKey | LKSVWSQIARDJDZ-UHFFFAOYSA-O |
| XLogP | 5.03 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|