C28H30NO8S+ — CID 25184124
6-[2-[(Z)-[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 25184124) has the molecular formula C28H30NO8S+ and a molecular weight of 540.61 g/mol. Its IUPAC name is 6-[2-[(Z)-[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(Z)-[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 25184124 |
| Molecular Formula | C28H30NO8S+ |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 6-[2-[(Z)-[2-hydroxy-3-(4-methoxyphenyl)-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | COc1ccc(C2=C(O)/C(=C/C3=[N+](CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H29NO8S/c1-28(2)21-15-19(38(34,35)36)12-13-22(21)29(14-6-4-5-7-24(30)31)23(28)16-20-26(32)25(27(20)33)17-8-10-18(37-3)11-9-17/h8-13,15-16H,4-7,14H2,1-3H3,(H2-,30,31,32,33,34,35,36)/p+1 |
| InChIKey | JJNLEFQPUFSPKS-UHFFFAOYSA-O |
| XLogP | 4.44 |
| TPSA | 141.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|