C31H33N2O4+ — CID 158348704
2-[3-[3-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]indol-1-yl]ethyl formate (PubChem CID 158348704) has the molecular formula C31H33N2O4+ and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[3-[3-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]indol-1-yl]ethyl formate.
| Compound Name | 2-[3-[3-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]indol-1-yl]ethyl formate |
|---|---|
| PubChem CID | 158348704 |
| Molecular Formula | C31H33N2O4+ |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 2-[3-[3-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]indol-1-yl]ethyl formate |
| SMILES | CC(C)CC[N+]1=C(C=C2C(=O)C(c3cn(CCOC=O)c4ccccc34)=C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H32N2O4/c1-20(2)13-14-33-26-12-8-6-10-24(26)31(3,4)27(33)17-22-29(35)28(30(22)36)23-18-32(15-16-37-19-34)25-11-7-5-9-21(23)25/h5-12,17-20H,13-16H2,1-4H3/p+1 |
| InChIKey | CZDPOHNTKUPQPM-UHFFFAOYSA-O |
| XLogP | 5.72 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|