C29H31N2O2+ — CID 72652274
4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxy-2-(1-methylindol-3-yl)cyclobut-2-en-1-one (PubChem CID 72652274) has the molecular formula C29H31N2O2+ and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxy-2-(1-methylindol-3-yl)cyclobut-2-en-1-one.
| Compound Name | 4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxy-2-(1-methylindol-3-yl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 72652274 |
| Molecular Formula | C29H31N2O2+ |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxy-2-(1-methylindol-3-yl)cyclobut-2-en-1-one |
| SMILES | CC(C)CC[N+]1=C(C=C2C(=O)C(c3cn(C)c4ccccc34)=C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H30N2O2/c1-18(2)14-15-31-24-13-9-7-11-22(24)29(3,4)25(31)16-20-27(32)26(28(20)33)21-17-30(5)23-12-8-6-10-19(21)23/h6-13,16-18H,14-15H2,1-5H3/p+1 |
| InChIKey | SBNOFJQNNBQPLR-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|