C34H37N2O5S+ — CID 91868354
(2E)-1-but-3-enyl-2-[[(3E)-3-[(1-but-3-enyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 91868354) has the molecular formula C34H37N2O5S+ and a molecular weight of 585.75 g/mol. Its IUPAC name is (2E)-1-but-3-enyl-2-[[(3E)-3-[(1-but-3-enyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | (2E)-1-but-3-enyl-2-[[(3E)-3-[(1-but-3-enyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 91868354 |
| Molecular Formula | C34H37N2O5S+ |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | (2E)-1-but-3-enyl-2-[[(3E)-3-[(1-but-3-enyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-2-hydroxy-4-oxocyclobuten-1-yl]methylidene]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | C=CCCN1/C(=C/C2=C(O)/C(=C\C3=[N+](CCC=C)c4ccccc4C3(C)C)C2=O)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C34H36N2O5S/c1-7-9-17-35-27-14-12-11-13-25(27)33(3,4)29(35)20-23-31(37)24(32(23)38)21-30-34(5,6)26-19-22(42(39,40)41)15-16-28(26)36(30)18-10-8-2/h7-8,11-16,19-21H,1-2,9-10,17-18H2,3-6H3,(H-,37,38,39,40,41)/p+1 |
| InChIKey | VYMOXFIVTRYINQ-UHFFFAOYSA-O |
| XLogP | 6.46 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|