C35H34N2O3 — CID 140609810
(4Z)-4-[[3,3-dimethyl-1-[2-(4-propan-2-yloxyphenyl)ethyl]indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate (PubChem CID 140609810) has the molecular formula C35H34N2O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is (4Z)-4-[[3,3-dimethyl-1-[2-(4-propan-2-yloxyphenyl)ethyl]indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[[3,3-dimethyl-1-[2-(4-propan-2-yloxyphenyl)ethyl]indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140609810 |
| Molecular Formula | C35H34N2O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | (4Z)-4-[[3,3-dimethyl-1-[2-(4-propan-2-yloxyphenyl)ethyl]indol-1-ium-2-yl]methylidene]-2-(1-methylindol-3-yl)-3-oxocyclobuten-1-olate |
| SMILES | CC(C)Oc1ccc(CC[N+]2=C(/C=C3\C(=O)C(c4cn(C)c5ccccc45)=C3[O-])C(C)(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C35H34N2O3/c1-22(2)40-24-16-14-23(15-17-24)18-19-37-30-13-9-7-11-28(30)35(3,4)31(37)20-26-33(38)32(34(26)39)27-21-36(5)29-12-8-6-10-25(27)29/h6-17,20-22H,18-19H2,1-5H3 |
| InChIKey | NHKSUQXYHUQHSR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 57.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|