C37H43N2O2+ — CID 90830831
2-[1-(4-cyclopenta-2,4-dien-1-ylbutyl)indol-3-yl]-4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxycyclobutan-1-one (PubChem CID 90830831) has the molecular formula C37H43N2O2+ and a molecular weight of 547.76 g/mol. Its IUPAC name is 2-[1-(4-cyclopenta-2,4-dien-1-ylbutyl)indol-3-yl]-4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxycyclobutan-1-one.
| Compound Name | 2-[1-(4-cyclopenta-2,4-dien-1-ylbutyl)indol-3-yl]-4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxycyclobutan-1-one |
|---|---|
| PubChem CID | 90830831 |
| Molecular Formula | C37H43N2O2+ |
| Molecular Weight | 547.76 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | 2-[1-(4-cyclopenta-2,4-dien-1-ylbutyl)indol-3-yl]-4-[[3,3-dimethyl-1-(3-methylbutyl)indol-1-ium-2-yl]methylidene]-3-hydroxycyclobutan-1-one |
| SMILES | CC(C)CC[N+]1=C(C=C2C(=O)C(c3cn(CCCCC4C=CC=C4)c4ccccc34)C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H43N2O2/c1-25(2)20-22-39-32-19-10-8-17-30(32)37(3,4)33(39)23-28-35(40)34(36(28)41)29-24-38(31-18-9-7-16-27(29)31)21-12-11-15-26-13-5-6-14-26/h5-10,13-14,16-19,23-26,34-35,40H,11-12,15,20-22H2,1-4H3/q+1 |
| InChIKey | UWLSTJCBYCHYIE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.76 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|