C39H41N4O8+ — CID 173114091
6-[2-[[3-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid (PubChem CID 173114091) has the molecular formula C39H41N4O8+ and a molecular weight of 693.78 g/mol. Its IUPAC name is 6-[2-[[3-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[[3-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 173114091 |
| Molecular Formula | C39H41N4O8+ |
| Molecular Weight | 693.78 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | 6-[2-[[3-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1(C)C(=CC2C(=O)C(=CC3=[N+](CCCCCC(=O)O)c4ccccc4C3(C)C)C2O)N(Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C39H40N4O8/c1-38(2)29-12-7-9-14-31(29)40(17-11-5-6-16-35(44)45)33(38)21-27-36(46)28(37(27)47)22-34-39(3,4)30-13-8-10-15-32(30)41(34)23-24-18-25(42(48)49)20-26(19-24)43(50)51/h7-10,12-15,18-22,28,36,46H,5-6,11,16-17,23H2,1-4H3/p+1 |
| InChIKey | ZJYDGNZFEKOFSC-UHFFFAOYSA-O |
| XLogP | 6.89 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|