C34H31N4O6+ — CID 73024965
2-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-dione (PubChem CID 73024965) has the molecular formula C34H31N4O6+ and a molecular weight of 591.64 g/mol. Its IUPAC name is 2-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-dione.
| Compound Name | 2-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 73024965 |
| Molecular Formula | C34H31N4O6+ |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 2-[[1-[(3,5-dinitrophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutane-1,3-dione |
| SMILES | CN1C(=CC2C(=O)C(=CC3=[N+](Cc4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)c4ccccc4C3(C)C)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H31N4O6/c1-33(2)25-10-6-8-12-27(25)35(5)29(33)17-23-31(39)24(32(23)40)18-30-34(3,4)26-11-7-9-13-28(26)36(30)19-20-14-21(37(41)42)16-22(15-20)38(43)44/h6-18,23H,19H2,1-5H3/q+1/b24-18-,29-17? |
| InChIKey | TXBPBYUDBMPXCU-FNTZDYPHSA-N |
| XLogP | 6.09 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|