C28H32N3O2+ — CID 91441626
3-(hydroxyamino)-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutan-1-one (PubChem CID 91441626) has the molecular formula C28H32N3O2+ and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-(hydroxyamino)-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutan-1-one.
| Compound Name | 3-(hydroxyamino)-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 91441626 |
| Molecular Formula | C28H32N3O2+ |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 3-(hydroxyamino)-2-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]-4-[(1,3,3-trimethylindol-2-ylidene)methyl]cyclobutan-1-one |
| SMILES | CN1C(=CC2C(=O)C(=CC3=[N+](C)c4ccccc4C3(C)C)C2NO)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H32N3O2/c1-27(2)19-11-7-9-13-21(19)30(5)23(27)15-17-25(29-33)18(26(17)32)16-24-28(3,4)20-12-8-10-14-22(20)31(24)6/h7-17,25,29,33H,1-6H3/q+1 |
| InChIKey | DSOHGHQALXXTNJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|