C36H47N2O4+ — CID 56634821
3-hydroxy-2-[[1-(5-hydroxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[[1-(5-hydroxypentyl)-3,3-dimethylindol-2-ylidene]methyl]cyclobutan-1-one (PubChem CID 56634821) has the molecular formula C36H47N2O4+ and a molecular weight of 571.78 g/mol. Its IUPAC name is 3-hydroxy-2-[[1-(5-hydroxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[[1-(5-hydroxypentyl)-3,3-dimethylindol-2-ylidene]methyl]cyclobutan-1-one.
| Compound Name | 3-hydroxy-2-[[1-(5-hydroxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[[1-(5-hydroxypentyl)-3,3-dimethylindol-2-ylidene]methyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 56634821 |
| Molecular Formula | C36H47N2O4+ |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | 3-hydroxy-2-[[1-(5-hydroxypentyl)-3,3-dimethylindol-1-ium-2-yl]methylidene]-4-[[1-(5-hydroxypentyl)-3,3-dimethylindol-2-ylidene]methyl]cyclobutan-1-one |
| SMILES | CC1(C)C(=CC2C(=O)C(=CC3=[N+](CCCCCO)c4ccccc4C3(C)C)C2O)N(CCCCCO)c2ccccc21 |
| InChI | InChI=1S/C36H47N2O4/c1-35(2)27-15-7-9-17-29(27)37(19-11-5-13-21-39)31(35)23-25-33(41)26(34(25)42)24-32-36(3,4)28-16-8-10-18-30(28)38(32)20-12-6-14-22-40/h7-10,15-18,23-25,33,39-41H,5-6,11-14,19-22H2,1-4H3/q+1 |
| InChIKey | VUSIDZDFDZQUBL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|