C40H38B2N2O6 — CID 177455196
(4Z)-4-[[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(Z)-[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate (PubChem CID 177455196) has the molecular formula C40H38B2N2O6 and a molecular weight of 664.38 g/mol. Its IUPAC name is (4Z)-4-[[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(Z)-[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-4-[[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(Z)-[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 177455196 |
| Molecular Formula | C40H38B2N2O6 |
| Molecular Weight | 664.38 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | (4Z)-4-[[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-1-ium-2-yl]methylidene]-2-[(Z)-[1-[(3-boronophenyl)methyl]-3,3-dimethylindol-2-ylidene]methyl]-3-oxocyclobuten-1-olate |
| SMILES | CC1(C)C(/C=C2\C(=O)C(/C=C3\N(Cc4cccc(B(O)O)c4)c4ccccc4C3(C)C)=C2[O-])=[N+](Cc2cccc(B(O)O)c2)c2ccccc21 |
| InChI | InChI=1S/C40H38B2N2O6/c1-39(2)31-15-5-7-17-33(31)43(23-25-11-9-13-27(19-25)41(47)48)35(39)21-29-37(45)30(38(29)46)22-36-40(3,4)32-16-6-8-18-34(32)44(36)24-26-12-10-14-28(20-26)42(49)50/h5-22,47-50H,23-24H2,1-4H3 |
| InChIKey | WMPCNUJPLYUVRY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|