C18H21BNO2+ — CID 162498325
[3-[(2,3,3-trimethylindol-1-ium-1-yl)methyl]phenyl]boronic acid (PubChem CID 162498325) has the molecular formula C18H21BNO2+ and a molecular weight of 294.18 g/mol. Its IUPAC name is [3-[(2,3,3-trimethylindol-1-ium-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [3-[(2,3,3-trimethylindol-1-ium-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 162498325 |
| Molecular Formula | C18H21BNO2+ |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [3-[(2,3,3-trimethylindol-1-ium-1-yl)methyl]phenyl]boronic acid |
| SMILES | CC1=[N+](Cc2cccc(B(O)O)c2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C18H21BNO2/c1-13-18(2,3)16-9-4-5-10-17(16)20(13)12-14-7-6-8-15(11-14)19(21)22/h4-11,21-22H,12H2,1-3H3/q+1 |
| InChIKey | NXZUYDGTQXACCR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|