C35H31N2O2+ — CID 91394969
3-hydroxy-2-[1-(4-methylphenyl)indol-3-yl]-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobutan-1-one (PubChem CID 91394969) has the molecular formula C35H31N2O2+ and a molecular weight of 511.65 g/mol. Its IUPAC name is 3-hydroxy-2-[1-(4-methylphenyl)indol-3-yl]-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobutan-1-one.
| Compound Name | 3-hydroxy-2-[1-(4-methylphenyl)indol-3-yl]-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobutan-1-one |
|---|---|
| PubChem CID | 91394969 |
| Molecular Formula | C35H31N2O2+ |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 3-hydroxy-2-[1-(4-methylphenyl)indol-3-yl]-4-[(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)methylidene]cyclobutan-1-one |
| SMILES | Cc1ccc(-n2cc(C3C(=O)C(=CC4=[N+](C)c5ccc6ccccc6c5C4(C)C)C3O)c3ccccc32)cc1 |
| InChI | InChI=1S/C35H31N2O2/c1-21-13-16-23(17-14-21)37-20-27(25-11-7-8-12-28(25)37)31-33(38)26(34(31)39)19-30-35(2,3)32-24-10-6-5-9-22(24)15-18-29(32)36(30)4/h5-20,31,33,38H,1-4H3/q+1 |
| InChIKey | NIFLOTJNTNMULV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|