C33H40N3O2+ — CID 143113003
2-[(1-butyl-3,3-dimethylindol-2-ylidene)methyl]-1,1,3-trimethylbenzo[e]indol-3-ium;3-nitroprop-1-ene (PubChem CID 143113003) has the molecular formula C33H40N3O2+ and a molecular weight of 510.70 g/mol. Its IUPAC name is 2-[(1-butyl-3,3-dimethylindol-2-ylidene)methyl]-1,1,3-trimethylbenzo[e]indol-3-ium;3-nitroprop-1-ene.
| Compound Name | 2-[(1-butyl-3,3-dimethylindol-2-ylidene)methyl]-1,1,3-trimethylbenzo[e]indol-3-ium;3-nitroprop-1-ene |
|---|---|
| PubChem CID | 143113003 |
| Molecular Formula | C33H40N3O2+ |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 2-[(1-butyl-3,3-dimethylindol-2-ylidene)methyl]-1,1,3-trimethylbenzo[e]indol-3-ium;3-nitroprop-1-ene |
| SMILES | C=CC[N+](=O)[O-].CCCCN1C(=CC2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H35N2.C3H5NO2/c1-7-8-19-32-24-16-12-11-15-23(24)29(2,3)27(32)20-26-30(4,5)28-22-14-10-9-13-21(22)17-18-25(28)31(26)6;1-2-3-4(5)6/h9-18,20H,7-8,19H2,1-6H3;2H,1,3H2/q+1; |
| InChIKey | QDTMNQOWHLIYNG-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|