C44H47N2O4S+ — CID 136623952
[1-butyl-2-[(E)-[3-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-yl] formate (PubChem CID 136623952) has the molecular formula C44H47N2O4S+ and a molecular weight of 699.94 g/mol. Its IUPAC name is [1-butyl-2-[(E)-[3-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-yl] formate.
| Compound Name | [1-butyl-2-[(E)-[3-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-yl] formate |
|---|---|
| PubChem CID | 136623952 |
| Molecular Formula | C44H47N2O4S+ |
| Molecular Weight | 699.94 g/mol |
| Exact Mass | 699.33 |
| IUPAC Name | [1-butyl-2-[(E)-[3-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-3,3-dimethylindol-1-ium-5-yl] formate |
| SMILES | CCCC[N+]1=C(/C=C2/C(=O)C(c3ccc(-n4c5ccc(C(C)(C)C)cc5c5cc(C(C)(C)C)ccc54)s3)=C2O)C(C)(C)c2cc(OC=O)ccc21 |
| InChI | InChI=1S/C44H46N2O4S/c1-10-11-20-45-35-17-14-28(50-25-47)23-32(35)44(8,9)37(45)24-31-40(48)39(41(31)49)36-18-19-38(51-36)46-33-15-12-26(42(2,3)4)21-29(33)30-22-27(43(5,6)7)13-16-34(30)46/h12-19,21-25H,10-11,20H2,1-9H3/p+1 |
| InChIKey | WXIATWUZDUXBRO-UHFFFAOYSA-O |
| XLogP | 10.63 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.94 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|