C14H18NS+ — CID 71396886
1,3,3-trimethyl-2-(2-methylsulfanylethenyl)indol-1-ium (PubChem CID 71396886) has the molecular formula C14H18NS+ and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-(2-methylsulfanylethenyl)indol-1-ium.
| Compound Name | 1,3,3-trimethyl-2-(2-methylsulfanylethenyl)indol-1-ium |
|---|---|
| PubChem CID | 71396886 |
| Molecular Formula | C14H18NS+ |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1,3,3-trimethyl-2-(2-methylsulfanylethenyl)indol-1-ium |
| SMILES | CSC=CC1=[N+](C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C14H18NS/c1-14(2)11-7-5-6-8-12(11)15(3)13(14)9-10-16-4/h5-10H,1-4H3/q+1 |
| InChIKey | CWFRZGSOUZTHRW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|