C23H34N3O2+ — CID 88567290
2,5-dibutoxy-N,4-dimethyl-N-[(E)-(1-methylpyridin-1-ium-2-yl)methylideneamino]aniline (PubChem CID 88567290) has the molecular formula C23H34N3O2+ and a molecular weight of 384.54 g/mol. Its IUPAC name is 2,5-dibutoxy-N,4-dimethyl-N-[(E)-(1-methylpyridin-1-ium-2-yl)methylideneamino]aniline.
| Compound Name | 2,5-dibutoxy-N,4-dimethyl-N-[(E)-(1-methylpyridin-1-ium-2-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 88567290 |
| Molecular Formula | C23H34N3O2+ |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 2,5-dibutoxy-N,4-dimethyl-N-[(E)-(1-methylpyridin-1-ium-2-yl)methylideneamino]aniline |
| SMILES | CCCCOc1cc(N(C)/N=C/c2cccc[n+]2C)c(OCCCC)cc1C |
| InChI | InChI=1S/C23H34N3O2/c1-6-8-14-27-22-17-21(23(16-19(22)3)28-15-9-7-2)26(5)24-18-20-12-10-11-13-25(20)4/h10-13,16-18H,6-9,14-15H2,1-5H3/q+1 |
| InChIKey | NOVWYMLQWQVQOJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|