C24H33NO2 — CID 102439863
1-(4-methyl-2,5-dipentoxyphenyl)-N-phenylmethanimine (PubChem CID 102439863) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-(4-methyl-2,5-dipentoxyphenyl)-N-phenylmethanimine.
| Compound Name | 1-(4-methyl-2,5-dipentoxyphenyl)-N-phenylmethanimine |
|---|---|
| PubChem CID | 102439863 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 1-(4-methyl-2,5-dipentoxyphenyl)-N-phenylmethanimine |
| SMILES | CCCCCOc1cc(/C=N/c2ccccc2)c(OCCCCC)cc1C |
| InChI | InChI=1S/C24H33NO2/c1-4-6-11-15-26-23-18-21(19-25-22-13-9-8-10-14-22)24(17-20(23)3)27-16-12-7-5-2/h8-10,13-14,17-19H,4-7,11-12,15-16H2,1-3H3/b25-19+ |
| InChIKey | ZPKWDZNSYPOENI-NCELDCMTSA-N |
| XLogP | 6.88 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|