C48H52O6Si2 — CID 59167408
3,8-dimethyl-2,9-dipentoxy-5,5,6,6-tetraphenoxybenzo[c][1,2]benzodisiline (PubChem CID 59167408) has the molecular formula C48H52O6Si2 and a molecular weight of 781.11 g/mol. Its IUPAC name is 3,8-dimethyl-2,9-dipentoxy-5,5,6,6-tetraphenoxybenzo[c][1,2]benzodisiline.
| Compound Name | 3,8-dimethyl-2,9-dipentoxy-5,5,6,6-tetraphenoxybenzo[c][1,2]benzodisiline |
|---|---|
| PubChem CID | 59167408 |
| Molecular Formula | C48H52O6Si2 |
| Molecular Weight | 781.11 g/mol |
| Exact Mass | 780.33 |
| IUPAC Name | 3,8-dimethyl-2,9-dipentoxy-5,5,6,6-tetraphenoxybenzo[c][1,2]benzodisiline |
| SMILES | CCCCCOc1cc2c(cc1C)[Si](Oc1ccccc1)(Oc1ccccc1)[Si](Oc1ccccc1)(Oc1ccccc1)c1cc(C)c(OCCCCC)cc1-2 |
| InChI | InChI=1S/C48H52O6Si2/c1-5-7-21-31-49-45-35-43-44-36-46(50-32-22-8-6-2)38(4)34-48(44)56(53-41-27-17-11-18-28-41,54-42-29-19-12-20-30-42)55(47(43)33-37(45)3,51-39-23-13-9-14-24-39)52-40-25-15-10-16-26-40/h9-20,23-30,33-36H,5-8,21-22,31-32H2,1-4H3 |
| InChIKey | FUZOBEKLFGSGED-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.11 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|