C46H62O2Si — CID 59167384
3,7-dimethyl-2,8-dipentoxy-5,5-bis(4-pentylphenyl)benzo[b][1]benzosilole (PubChem CID 59167384) has the molecular formula C46H62O2Si and a molecular weight of 675.09 g/mol. Its IUPAC name is 3,7-dimethyl-2,8-dipentoxy-5,5-bis(4-pentylphenyl)benzo[b][1]benzosilole.
| Compound Name | 3,7-dimethyl-2,8-dipentoxy-5,5-bis(4-pentylphenyl)benzo[b][1]benzosilole |
|---|---|
| PubChem CID | 59167384 |
| Molecular Formula | C46H62O2Si |
| Molecular Weight | 675.09 g/mol |
| Exact Mass | 674.45 |
| IUPAC Name | 3,7-dimethyl-2,8-dipentoxy-5,5-bis(4-pentylphenyl)benzo[b][1]benzosilole |
| SMILES | CCCCCOc1cc2c(cc1C)[Si](c1ccc(CCCCC)cc1)(c1ccc(CCCCC)cc1)c1cc(C)c(OCCCCC)cc1-2 |
| InChI | InChI=1S/C46H62O2Si/c1-7-11-15-19-37-21-25-39(26-22-37)49(40-27-23-38(24-28-40)20-16-12-8-2)45-31-35(5)43(47-29-17-13-9-3)33-41(45)42-34-44(36(6)32-46(42)49)48-30-18-14-10-4/h21-28,31-34H,7-20,29-30H2,1-6H3 |
| InChIKey | JBDFSPNOSXAVKH-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.09 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|