C68H92O4Si2 — CID 59096238
3,8-dimethyl-2,9-dipentoxy-5,5-bis(4-pentoxyphenyl)-6,6-bis(4-pentylphenyl)benzo[c][1,2]benzodisiline (PubChem CID 59096238) has the molecular formula C68H92O4Si2 and a molecular weight of 1029.65 g/mol. Its IUPAC name is 3,8-dimethyl-2,9-dipentoxy-5,5-bis(4-pentoxyphenyl)-6,6-bis(4-pentylphenyl)benzo[c][1,2]benzodisiline.
| Compound Name | 3,8-dimethyl-2,9-dipentoxy-5,5-bis(4-pentoxyphenyl)-6,6-bis(4-pentylphenyl)benzo[c][1,2]benzodisiline |
|---|---|
| PubChem CID | 59096238 |
| Molecular Formula | C68H92O4Si2 |
| Molecular Weight | 1029.65 g/mol |
| Exact Mass | 1028.65 |
| IUPAC Name | 3,8-dimethyl-2,9-dipentoxy-5,5-bis(4-pentoxyphenyl)-6,6-bis(4-pentylphenyl)benzo[c][1,2]benzodisiline |
| SMILES | CCCCCOc1ccc([Si]2(c3ccc(OCCCCC)cc3)c3cc(C)c(OCCCCC)cc3-c3cc(OCCCCC)c(C)cc3[Si]2(c2ccc(CCCCC)cc2)c2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C68H92O4Si2/c1-9-15-21-27-55-29-37-59(38-30-55)73(60-39-31-56(32-40-60)28-22-16-10-2)67-49-53(7)65(71-47-25-19-13-5)51-63(67)64-52-66(72-48-26-20-14-6)54(8)50-68(64)74(73,61-41-33-57(34-42-61)69-45-23-17-11-3)62-43-35-58(36-44-62)70-46-24-18-12-4/h29-44,49-52H,9-28,45-48H2,1-8H3 |
| InChIKey | HBKWHUQHYBYISX-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.65 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|