C44H49NOSi — CID 158748708
3-[6-[3,7-dimethyl-5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-2-yl]oxyhexyl]-2,2-dimethyl-1-phenylaziridine (PubChem CID 158748708) has the molecular formula C44H49NOSi and a molecular weight of 635.97 g/mol. Its IUPAC name is 3-[6-[3,7-dimethyl-5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-2-yl]oxyhexyl]-2,2-dimethyl-1-phenylaziridine.
| Compound Name | 3-[6-[3,7-dimethyl-5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-2-yl]oxyhexyl]-2,2-dimethyl-1-phenylaziridine |
|---|---|
| PubChem CID | 158748708 |
| Molecular Formula | C44H49NOSi |
| Molecular Weight | 635.97 g/mol |
| Exact Mass | 635.36 |
| IUPAC Name | 3-[6-[3,7-dimethyl-5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-2-yl]oxyhexyl]-2,2-dimethyl-1-phenylaziridine |
| SMILES | Cc1ccc([Si]2(c3ccc(C)cc3)c3cc(C)ccc3-c3cc(OCCCCCCC4N(c5ccccc5)C4(C)C)c(C)cc32)cc1 |
| InChI | InChI=1S/C44H49NOSi/c1-31-17-22-36(23-18-31)47(37-24-19-32(2)20-25-37)41-28-33(3)21-26-38(41)39-30-40(34(4)29-42(39)47)46-27-13-8-7-12-16-43-44(5,6)45(43)35-14-10-9-11-15-35/h9-11,14-15,17-26,28-30,43H,7-8,12-13,16,27H2,1-6H3 |
| InChIKey | HHYLGRAVEGGCHC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.97 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|