C70H81N3O5 — CID 88854094
2-[4-[2,5-dihexoxy-4-(6-methyl-9-phenylcarbazol-3-yl)phenyl]phenyl]-5-[4-(2,5-dihexoxy-4-methylphenyl)phenyl]-1,3,4-oxadiazole (PubChem CID 88854094) has the molecular formula C70H81N3O5 and a molecular weight of 1044.43 g/mol. Its IUPAC name is 2-[4-[2,5-dihexoxy-4-(6-methyl-9-phenylcarbazol-3-yl)phenyl]phenyl]-5-[4-(2,5-dihexoxy-4-methylphenyl)phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-[2,5-dihexoxy-4-(6-methyl-9-phenylcarbazol-3-yl)phenyl]phenyl]-5-[4-(2,5-dihexoxy-4-methylphenyl)phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 88854094 |
| Molecular Formula | C70H81N3O5 |
| Molecular Weight | 1044.43 g/mol |
| Exact Mass | 1043.62 |
| IUPAC Name | 2-[4-[2,5-dihexoxy-4-(6-methyl-9-phenylcarbazol-3-yl)phenyl]phenyl]-5-[4-(2,5-dihexoxy-4-methylphenyl)phenyl]-1,3,4-oxadiazole |
| SMILES | CCCCCCOc1cc(-c2ccc(-c3nnc(-c4ccc(-c5cc(OCCCCCC)c(-c6ccc7c(c6)c6cc(C)ccc6n7-c6ccccc6)cc5OCCCCCC)cc4)o3)cc2)c(OCCCCCC)cc1C |
| InChI | InChI=1S/C70H81N3O5/c1-7-11-15-22-40-74-65-47-58(66(45-51(65)6)75-41-23-16-12-8-2)52-29-33-54(34-30-52)69-71-72-70(78-69)55-35-31-53(32-36-55)59-48-68(77-43-25-18-14-10-4)60(49-67(59)76-42-24-17-13-9-3)56-37-39-64-62(46-56)61-44-50(5)28-38-63(61)73(64)57-26-20-19-21-27-57/h19-21,26-39,44-49H,7-18,22-25,40-43H2,1-6H3 |
| InChIKey | LSYYMWFMRDKGSF-UHFFFAOYSA-N |
| XLogP | 19.95 |
| TPSA | 80.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.43 |
| LogP ≤ 5 | 19.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|