C21H32N2O3 — CID 20764472
2-(5-hexoxy-4-methyl-2-pentoxyphenyl)-5-methyl-1,3,4-oxadiazole (PubChem CID 20764472) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-(5-hexoxy-4-methyl-2-pentoxyphenyl)-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-(5-hexoxy-4-methyl-2-pentoxyphenyl)-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 20764472 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 2-(5-hexoxy-4-methyl-2-pentoxyphenyl)-5-methyl-1,3,4-oxadiazole |
| SMILES | CCCCCCOc1cc(-c2nnc(C)o2)c(OCCCCC)cc1C |
| InChI | InChI=1S/C21H32N2O3/c1-5-7-9-11-13-24-19-15-18(21-23-22-17(4)26-21)20(14-16(19)3)25-12-10-8-6-2/h14-15H,5-13H2,1-4H3 |
| InChIKey | ZTMVHSXJLUSDHZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|