C15H18BrClN2O2 — CID 54852793
2-(5-bromo-2-hexoxyphenyl)-5-(chloromethyl)-1,3,4-oxadiazole (PubChem CID 54852793) has the molecular formula C15H18BrClN2O2 and a molecular weight of 373.68 g/mol. Its IUPAC name is 2-(5-bromo-2-hexoxyphenyl)-5-(chloromethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(5-bromo-2-hexoxyphenyl)-5-(chloromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 54852793 |
| Molecular Formula | C15H18BrClN2O2 |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-(5-bromo-2-hexoxyphenyl)-5-(chloromethyl)-1,3,4-oxadiazole |
| SMILES | CCCCCCOc1ccc(Br)cc1-c1nnc(CCl)o1 |
| InChI | InChI=1S/C15H18BrClN2O2/c1-2-3-4-5-8-20-13-7-6-11(16)9-12(13)15-19-18-14(10-17)21-15/h6-7,9H,2-5,8,10H2,1H3 |
| InChIKey | ZTVAMRNESQRDAI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|