C19H24N2O — CID 169381913
N-[(4-butoxy-2,6-dimethylphenyl)methylideneamino]aniline (PubChem CID 169381913) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(4-butoxy-2,6-dimethylphenyl)methylideneamino]aniline.
| Compound Name | N-[(4-butoxy-2,6-dimethylphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 169381913 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[(4-butoxy-2,6-dimethylphenyl)methylideneamino]aniline |
| SMILES | CCCCOc1cc(C)c(C=NNc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H24N2O/c1-4-5-11-22-18-12-15(2)19(16(3)13-18)14-20-21-17-9-7-6-8-10-17/h6-10,12-14,21H,4-5,11H2,1-3H3 |
| InChIKey | CVTYJNRHCWQVBR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|