C18H20F2N2O — CID 169381901
N-[(3,4-difluoro-5-pentoxyphenyl)methylideneamino]aniline (PubChem CID 169381901) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[(3,4-difluoro-5-pentoxyphenyl)methylideneamino]aniline.
| Compound Name | N-[(3,4-difluoro-5-pentoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 169381901 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(3,4-difluoro-5-pentoxyphenyl)methylideneamino]aniline |
| SMILES | CCCCCOc1cc(C=NNc2ccccc2)cc(F)c1F |
| InChI | InChI=1S/C18H20F2N2O/c1-2-3-7-10-23-17-12-14(11-16(19)18(17)20)13-21-22-15-8-5-4-6-9-15/h4-6,8-9,11-13,22H,2-3,7,10H2,1H3 |
| InChIKey | CEPCYGQDNPFZCQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|