C19H23FN2O — CID 169382049
N-[(3-fluoro-5-hexoxyphenyl)methylideneamino]aniline (PubChem CID 169382049) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is N-[(3-fluoro-5-hexoxyphenyl)methylideneamino]aniline.
| Compound Name | N-[(3-fluoro-5-hexoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 169382049 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-[(3-fluoro-5-hexoxyphenyl)methylideneamino]aniline |
| SMILES | CCCCCCOc1cc(F)cc(C=NNc2ccccc2)c1 |
| InChI | InChI=1S/C19H23FN2O/c1-2-3-4-8-11-23-19-13-16(12-17(20)14-19)15-21-22-18-9-6-5-7-10-18/h5-7,9-10,12-15,22H,2-4,8,11H2,1H3 |
| InChIKey | HGSYUALXWDAAMG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|