C29H28F3IN2 — CID 73164059
3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium iodide (PubChem CID 73164059) has the molecular formula C29H28F3IN2 and a molecular weight of 588.46 g/mol. Its IUPAC name is 3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium iodide.
| Compound Name | 3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium iodide |
|---|---|
| PubChem CID | 73164059 |
| Molecular Formula | C29H28F3IN2 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]-1-[(3,4,5-trifluorophenyl)methyl]indol-1-ium iodide |
| SMILES | CC1(C)C(C=Cc2ccc(N3CCCC3)cc2)=[N+](Cc2cc(F)c(F)c(F)c2)c2ccccc21.[I-] |
| InChI | InChI=1S/C29H28F3N2.HI/c1-29(2)23-7-3-4-8-26(23)34(19-21-17-24(30)28(32)25(31)18-21)27(29)14-11-20-9-12-22(13-10-20)33-15-5-6-16-33;/h3-4,7-14,17-18H,5-6,15-16,19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CYZHTCDXMHWONF-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|