C18H22NS+ — CID 765944
2-[(Z)-[(5R)-3,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 765944) has the molecular formula C18H22NS+ and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-[(Z)-[(5R)-3,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(Z)-[(5R)-3,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 765944 |
| Molecular Formula | C18H22NS+ |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[(Z)-[(5R)-3,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C2\C=C(C)C[C@@H](C)C2)sc2ccccc21 |
| InChI | InChI=1S/C18H22NS/c1-4-19-16-7-5-6-8-17(16)20-18(19)12-15-10-13(2)9-14(3)11-15/h5-8,10,12,14H,4,9,11H2,1-3H3/q+1/b15-12+/t14-/m1/s1 |
| InChIKey | OTYHHPGJORTTBO-FQZGENGWSA-N |
| XLogP | 4.97 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|