C23H22N3S+ — CID 24789752
N-(4-ethylphenyl)-5-(3-methylphenyl)-4-phenyl-1,3,4-thiadiazol-4-ium-2-amine (PubChem CID 24789752) has the molecular formula C23H22N3S+ and a molecular weight of 372.52 g/mol. Its IUPAC name is N-(4-ethylphenyl)-5-(3-methylphenyl)-4-phenyl-1,3,4-thiadiazol-4-ium-2-amine.
| Compound Name | N-(4-ethylphenyl)-5-(3-methylphenyl)-4-phenyl-1,3,4-thiadiazol-4-ium-2-amine |
|---|---|
| PubChem CID | 24789752 |
| Molecular Formula | C23H22N3S+ |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-(4-ethylphenyl)-5-(3-methylphenyl)-4-phenyl-1,3,4-thiadiazol-4-ium-2-amine |
| SMILES | CCc1ccc(Nc2n[n+](-c3ccccc3)c(-c3cccc(C)c3)s2)cc1 |
| InChI | InChI=1S/C23H22N3S/c1-3-18-12-14-20(15-13-18)24-23-25-26(21-10-5-4-6-11-21)22(27-23)19-9-7-8-17(2)16-19/h4-16H,3H2,1-2H3,(H,24,25)/q+1 |
| InChIKey | GGOBLNCIDYYEIH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|