C23H20ClN3O2S — CID 24789815
4-[5-(4-ethylanilino)-3-phenyl-1,3,4-thiadiazol-3-ium-2-yl]benzoic acid chloride (PubChem CID 24789815) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 4-[5-(4-ethylanilino)-3-phenyl-1,3,4-thiadiazol-3-ium-2-yl]benzoic acid chloride.
| Compound Name | 4-[5-(4-ethylanilino)-3-phenyl-1,3,4-thiadiazol-3-ium-2-yl]benzoic acid chloride |
|---|---|
| PubChem CID | 24789815 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-[5-(4-ethylanilino)-3-phenyl-1,3,4-thiadiazol-3-ium-2-yl]benzoic acid chloride |
| SMILES | CCc1ccc(Nc2n[n+](-c3ccccc3)c(-c3ccc(C(=O)O)cc3)s2)cc1.[Cl-] |
| InChI | InChI=1S/C23H19N3O2S.ClH/c1-2-16-8-14-19(15-9-16)24-23-25-26(20-6-4-3-5-7-20)21(29-23)17-10-12-18(13-11-17)22(27)28;/h3-15H,2H2,1H3,(H-,24,25,27,28);1H |
| InChIKey | XIJPGRLLTSQDLI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|