C17H17N4OS+ — CID 24789689
N-[4-(5-anilino-3-methyl-1,3,4-thiadiazol-3-ium-2-yl)phenyl]acetamide (PubChem CID 24789689) has the molecular formula C17H17N4OS+ and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[4-(5-anilino-3-methyl-1,3,4-thiadiazol-3-ium-2-yl)phenyl]acetamide.
| Compound Name | N-[4-(5-anilino-3-methyl-1,3,4-thiadiazol-3-ium-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 24789689 |
| Molecular Formula | C17H17N4OS+ |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[4-(5-anilino-3-methyl-1,3,4-thiadiazol-3-ium-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2sc(Nc3ccccc3)n[n+]2C)cc1 |
| InChI | InChI=1S/C17H16N4OS/c1-12(22)18-15-10-8-13(9-11-15)16-21(2)20-17(23-16)19-14-6-4-3-5-7-14/h3-11H,1-2H3,(H,19,20)/p+1 |
| InChIKey | SWRSIMVSPIVWTC-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 57.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|